C20H13ClFNO4 — CID 9355878
6-chloro-7-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methoxy]-4-methylchromen-2-one (PubChem CID 9355878) has the molecular formula C20H13ClFNO4 and a molecular weight of 385.78 g/mol. Its IUPAC name is 6-chloro-7-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 6-chloro-7-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 9355878 |
| Molecular Formula | C20H13ClFNO4 |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 6-chloro-7-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3ncc(-c4ccc(F)cc4)o3)c(Cl)cc12 |
| InChI | InChI=1S/C20H13ClFNO4/c1-11-6-20(24)27-16-8-17(15(21)7-14(11)16)25-10-19-23-9-18(26-19)12-2-4-13(22)5-3-12/h2-9H,10H2,1H3 |
| InChIKey | JLSFRFAHNIXKCG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|