C14H10ClNO3S — CID 166372173
6-chloro-4-methyl-7-(1,2-thiazol-5-ylmethoxy)chromen-2-one (PubChem CID 166372173) has the molecular formula C14H10ClNO3S and a molecular weight of 307.76 g/mol. Its IUPAC name is 6-chloro-4-methyl-7-(1,2-thiazol-5-ylmethoxy)chromen-2-one.
| Compound Name | 6-chloro-4-methyl-7-(1,2-thiazol-5-ylmethoxy)chromen-2-one |
|---|---|
| PubChem CID | 166372173 |
| Molecular Formula | C14H10ClNO3S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 6-chloro-4-methyl-7-(1,2-thiazol-5-ylmethoxy)chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3ccns3)c(Cl)cc12 |
| InChI | InChI=1S/C14H10ClNO3S/c1-8-4-14(17)19-12-6-13(11(15)5-10(8)12)18-7-9-2-3-16-20-9/h2-6H,7H2,1H3 |
| InChIKey | YWCQDKGVUHCASB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|