C22H20ClFN2O4 — CID 4892556
6-chloro-7-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one (PubChem CID 4892556) has the molecular formula C22H20ClFN2O4 and a molecular weight of 430.86 g/mol. Its IUPAC name is 6-chloro-7-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one.
| Compound Name | 6-chloro-7-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 4892556 |
| Molecular Formula | C22H20ClFN2O4 |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 6-chloro-7-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)N3CCN(c4ccc(F)cc4)CC3)c(Cl)cc12 |
| InChI | InChI=1S/C22H20ClFN2O4/c1-14-10-22(28)30-19-12-20(18(23)11-17(14)19)29-13-21(27)26-8-6-25(7-9-26)16-4-2-15(24)3-5-16/h2-5,10-12H,6-9,13H2,1H3 |
| InChIKey | VRDIENRVHZWTDP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|