C20H23FN2O2 — CID 17217386
2-(2,5-dimethylphenoxy)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 17217386) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,5-dimethylphenoxy)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17217386 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(C)c(OCC(=O)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H23FN2O2/c1-15-3-4-16(2)19(13-15)25-14-20(24)23-11-9-22(10-12-23)18-7-5-17(21)6-8-18/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | LPCMJTPWXVABFA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |