C18H20ClNO4 — CID 7954018
6-chloro-4-methyl-7-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]chromen-2-one (PubChem CID 7954018) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is 6-chloro-4-methyl-7-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]chromen-2-one.
| Compound Name | 6-chloro-4-methyl-7-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 7954018 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 6-chloro-4-methyl-7-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)N3CCC(C)CC3)c(Cl)cc12 |
| InChI | InChI=1S/C18H20ClNO4/c1-11-3-5-20(6-4-11)17(21)10-23-16-9-15-13(8-14(16)19)12(2)7-18(22)24-15/h7-9,11H,3-6,10H2,1-2H3 |
| InChIKey | MXZSHHHKAJEAJM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|