C23H23ClN2O4 — CID 4823857
2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 4823857) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4823857 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Nc3ccc(N4CCCCC4)cc3)c(Cl)cc12 |
| InChI | InChI=1S/C23H23ClN2O4/c1-15-11-23(28)30-20-13-21(19(24)12-18(15)20)29-14-22(27)25-16-5-7-17(8-6-16)26-9-3-2-4-10-26/h5-8,11-13H,2-4,9-10,14H2,1H3,(H,25,27) |
| InChIKey | MODNHLIUMCWYOQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|