C20H23ClN2O2 — CID 1245566
2-(4-chloro-3,5-dimethylphenoxy)-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 1245566) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 1245566 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc(N3CCCC3)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C20H23ClN2O2/c1-14-11-18(12-15(2)20(14)21)25-13-19(24)22-16-5-7-17(8-6-16)23-9-3-4-10-23/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H,22,24) |
| InChIKey | PXSLRESASRTRRI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|