C29H28ClN3O4 — CID 17092069
N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-2-(4-chloro-3,5-dimethylphenoxy)acetamide (PubChem CID 17092069) has the molecular formula C29H28ClN3O4 and a molecular weight of 518.01 g/mol. Its IUPAC name is N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-2-(4-chloro-3,5-dimethylphenoxy)acetamide.
| Compound Name | N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-2-(4-chloro-3,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 17092069 |
| Molecular Formula | C29H28ClN3O4 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-2-(4-chloro-3,5-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc(N3CCN(C(=O)c4cc5ccccc5o4)CC3)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C29H28ClN3O4/c1-19-15-24(16-20(2)28(19)30)36-18-27(34)31-22-7-9-23(10-8-22)32-11-13-33(14-12-32)29(35)26-17-21-5-3-4-6-25(21)37-26/h3-10,15-17H,11-14,18H2,1-2H3,(H,31,34) |
| InChIKey | BMFAYUHYWYEXMC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|