C32H35N3O6 — CID 17091685
N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-3,4,5-triethoxybenzamide (PubChem CID 17091685) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 17091685 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(N3CCN(C(=O)c4cc5ccccc5o4)CC3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C32H35N3O6/c1-4-38-27-20-23(21-28(39-5-2)30(27)40-6-3)31(36)33-24-11-13-25(14-12-24)34-15-17-35(18-16-34)32(37)29-19-22-9-7-8-10-26(22)41-29/h7-14,19-21H,4-6,15-18H2,1-3H3,(H,33,36) |
| InChIKey | OGDMQIXEJPPIGM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|