C31H36ClN3O6 — CID 17092762
N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3,4,5-triethoxybenzamide (PubChem CID 17092762) has the molecular formula C31H36ClN3O6 and a molecular weight of 582.10 g/mol. Its IUPAC name is N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 17092762 |
| Molecular Formula | C31H36ClN3O6 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(N3CCN(C(=O)c4cc(Cl)ccc4OC)CC3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C31H36ClN3O6/c1-5-39-27-18-21(19-28(40-6-2)29(27)41-7-3)30(36)33-23-9-11-24(12-10-23)34-14-16-35(17-15-34)31(37)25-20-22(32)8-13-26(25)38-4/h8-13,18-20H,5-7,14-17H2,1-4H3,(H,33,36) |
| InChIKey | JVLSRQNGLXLSSQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|