C29H25Cl2N3O4 — CID 17092847
N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-5-(2-chlorophenyl)furan-2-carboxamide (PubChem CID 17092847) has the molecular formula C29H25Cl2N3O4 and a molecular weight of 550.44 g/mol. Its IUPAC name is N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-5-(2-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-5-(2-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17092847 |
| Molecular Formula | C29H25Cl2N3O4 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-5-(2-chlorophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4ccccc4Cl)o3)cc2)CC1 |
| InChI | InChI=1S/C29H25Cl2N3O4/c1-37-25-11-6-19(30)18-23(25)29(36)34-16-14-33(15-17-34)21-9-7-20(8-10-21)32-28(35)27-13-12-26(38-27)22-4-2-3-5-24(22)31/h2-13,18H,14-17H2,1H3,(H,32,35) |
| InChIKey | KXAYGINYEWZRLT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|