C26H27Cl2N3O3 — CID 17335316
5-(2,5-dichlorophenyl)-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]furan-2-carboxamide (PubChem CID 17335316) has the molecular formula C26H27Cl2N3O3 and a molecular weight of 500.43 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | 5-(2,5-dichlorophenyl)-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17335316 |
| Molecular Formula | C26H27Cl2N3O3 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4cc(Cl)ccc4Cl)o3)cc2)CC1 |
| InChI | InChI=1S/C26H27Cl2N3O3/c1-17(2)15-25(32)31-13-11-30(12-14-31)20-6-4-19(5-7-20)29-26(33)24-10-9-23(34-24)21-16-18(27)3-8-22(21)28/h3-10,16-17H,11-15H2,1-2H3,(H,29,33) |
| InChIKey | SSOZKTXFJCFDKE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|