C22H25ClN4O4 — CID 17335283
2-chloro-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-4-nitrobenzamide (PubChem CID 17335283) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is 2-chloro-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 17335283 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-chloro-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-4-nitrobenzamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN4O4/c1-15(2)13-21(28)26-11-9-25(10-12-26)17-5-3-16(4-6-17)24-22(29)19-8-7-18(27(30)31)14-20(19)23/h3-8,14-15H,9-13H2,1-2H3,(H,24,29) |
| InChIKey | SHNNFDJUYXBTJJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|