C27H18Cl2N4O6 — CID 5192048
2-chloro-N-[4-[[4-[(2-chloro-4-nitrobenzoyl)amino]phenyl]methyl]phenyl]-4-nitrobenzamide (PubChem CID 5192048) has the molecular formula C27H18Cl2N4O6 and a molecular weight of 565.37 g/mol. Its IUPAC name is 2-chloro-N-[4-[[4-[(2-chloro-4-nitrobenzoyl)amino]phenyl]methyl]phenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[[4-[(2-chloro-4-nitrobenzoyl)amino]phenyl]methyl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5192048 |
| Molecular Formula | C27H18Cl2N4O6 |
| Molecular Weight | 565.37 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | 2-chloro-N-[4-[[4-[(2-chloro-4-nitrobenzoyl)amino]phenyl]methyl]phenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)cc2)cc1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C27H18Cl2N4O6/c28-24-14-20(32(36)37)9-11-22(24)26(34)30-18-5-1-16(2-6-18)13-17-3-7-19(8-4-17)31-27(35)23-12-10-21(33(38)39)15-25(23)29/h1-12,14-15H,13H2,(H,30,34)(H,31,35) |
| InChIKey | LZWKVZUCNBOXSC-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.37 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|