C13H10ClN3O5S — CID 1350235
2-chloro-4-nitro-N-(4-sulfamoylphenyl)benzamide (PubChem CID 1350235) has the molecular formula C13H10ClN3O5S and a molecular weight of 355.76 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-chloro-4-nitro-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 1350235 |
| Molecular Formula | C13H10ClN3O5S |
| Molecular Weight | 355.76 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-chloro-4-nitro-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C13H10ClN3O5S/c14-12-7-9(17(19)20)3-6-11(12)13(18)16-8-1-4-10(5-2-8)23(15,21)22/h1-7H,(H,16,18)(H2,15,21,22) |
| InChIKey | RYNWTIXQTVFOEO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|