C15H12ClN3O7S — CID 5065869
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-chloro-5-nitrobenzoate (PubChem CID 5065869) has the molecular formula C15H12ClN3O7S and a molecular weight of 413.80 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 5065869 |
| Molecular Formula | C15H12ClN3O7S |
| Molecular Weight | 413.80 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-chloro-5-nitrobenzoate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C15H12ClN3O7S/c16-13-6-3-10(19(22)23)7-12(13)15(21)26-8-14(20)18-9-1-4-11(5-2-9)27(17,24)25/h1-7H,8H2,(H,18,20)(H2,17,24,25) |
| InChIKey | KSMIYTOMXFFDST-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.80 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|