C17H13ClFN3O6 — CID 2631464
[2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-5-nitrobenzoate (PubChem CID 2631464) has the molecular formula C17H13ClFN3O6 and a molecular weight of 409.76 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 2631464 |
| Molecular Formula | C17H13ClFN3O6 |
| Molecular Weight | 409.76 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1Cl)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13ClFN3O6/c18-14-6-5-12(22(26)27)7-13(14)17(25)28-9-16(24)20-8-15(23)21-11-3-1-10(19)2-4-11/h1-7H,8-9H2,(H,20,24)(H,21,23) |
| InChIKey | PNNHYHLFGORJNR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|