C19H18FN3O5 — CID 7837390
[2-(4-fluoroanilino)-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate (PubChem CID 7837390) has the molecular formula C19H18FN3O5 and a molecular weight of 387.37 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 7837390 |
| Molecular Formula | C19H18FN3O5 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FN3O5/c20-13-3-5-14(6-4-13)21-18(24)12-28-19(25)16-11-15(23(26)27)7-8-17(16)22-9-1-2-10-22/h3-8,11H,1-2,9-10,12H2,(H,21,24) |
| InChIKey | UXPRVKWGFWIWEF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|