C19H17F2N3O6 — CID 18075404
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 18075404) has the molecular formula C19H17F2N3O6 and a molecular weight of 421.36 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 18075404 |
| Molecular Formula | C19H17F2N3O6 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F2N3O6/c20-15-3-1-12(9-16(15)21)22-18(25)11-30-19(26)14-10-13(24(27)28)2-4-17(14)23-5-7-29-8-6-23/h1-4,9-10H,5-8,11H2,(H,22,25) |
| InChIKey | WNLVEHQLVFOVJX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|