C19H18IN3O6 — CID 16542090
[2-(2-iodoanilino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 16542090) has the molecular formula C19H18IN3O6 and a molecular weight of 511.27 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 16542090 |
| Molecular Formula | C19H18IN3O6 |
| Molecular Weight | 511.27 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1)Nc1ccccc1I |
| InChI | InChI=1S/C19H18IN3O6/c20-15-3-1-2-4-16(15)21-18(24)12-29-19(25)14-11-13(23(26)27)5-6-17(14)22-7-9-28-10-8-22/h1-6,11H,7-10,12H2,(H,21,24) |
| InChIKey | INMRSDUADSYPFG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|