C17H22N4O7 — CID 16959003
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 16959003) has the molecular formula C17H22N4O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 16959003 |
| Molecular Formula | C17H22N4O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C17H22N4O7/c1-11(2)18-17(24)19-15(22)10-28-16(23)13-9-12(21(25)26)3-4-14(13)20-5-7-27-8-6-20/h3-4,9,11H,5-8,10H2,1-2H3,(H2,18,19,22,24) |
| InChIKey | RZSADKOWMNOTDX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|