C16H17F3N4O7 — CID 27343158
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 27343158) has the molecular formula C16H17F3N4O7 and a molecular weight of 434.33 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 27343158 |
| Molecular Formula | C16H17F3N4O7 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C16H17F3N4O7/c17-16(18,19)9-20-15(26)21-13(24)8-30-14(25)11-7-10(23(27)28)1-2-12(11)22-3-5-29-6-4-22/h1-2,7H,3-6,8-9H2,(H2,20,21,24,26) |
| InChIKey | FWSBJDYAFLKALZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|