C19H17N5O6S — CID 55321134
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 55321134) has the molecular formula C19H17N5O6S and a molecular weight of 443.44 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 55321134 |
| Molecular Formula | C19H17N5O6S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C19H17N5O6S/c25-17(20-14-2-1-3-15-18(14)22-31-21-15)11-30-19(26)13-10-12(24(27)28)4-5-16(13)23-6-8-29-9-7-23/h1-5,10H,6-9,11H2,(H,20,25) |
| InChIKey | ZUSDJIVNQPXMJV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|