C15H9ClN4O5S — CID 7718509
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-chloro-4-nitrobenzoate (PubChem CID 7718509) has the molecular formula C15H9ClN4O5S and a molecular weight of 392.78 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-chloro-4-nitrobenzoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 7718509 |
| Molecular Formula | C15H9ClN4O5S |
| Molecular Weight | 392.78 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-chloro-4-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])cc1Cl)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C15H9ClN4O5S/c16-10-6-8(20(23)24)4-5-9(10)15(22)25-7-13(21)17-11-2-1-3-12-14(11)19-26-18-12/h1-6H,7H2,(H,17,21) |
| InChIKey | HREWTKJQYQRBHZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|