C17H15N3O4S — CID 7758270
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-ethoxybenzoate (PubChem CID 7758270) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-ethoxybenzoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 7758270 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCC(=O)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C17H15N3O4S/c1-2-23-14-9-4-3-6-11(14)17(22)24-10-15(21)18-12-7-5-8-13-16(12)20-25-19-13/h3-9H,2,10H2,1H3,(H,18,21) |
| InChIKey | YXVYIHRKVDDRFS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |