C20H21N3O5S — CID 42979562
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-butoxy-3-methoxybenzoate (PubChem CID 42979562) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-butoxy-3-methoxybenzoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 42979562 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)Nc2cccc3nsnc23)cc1OC |
| InChI | InChI=1S/C20H21N3O5S/c1-3-4-10-27-16-9-8-13(11-17(16)26-2)20(25)28-12-18(24)21-14-6-5-7-15-19(14)23-29-22-15/h5-9,11H,3-4,10,12H2,1-2H3,(H,21,24) |
| InChIKey | CIMMYSFRVVGSJZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|