C23H23N5O4S — CID 16502863
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate (PubChem CID 16502863) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 16502863 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCCCn1nc(C(=O)OCC(=O)Nc2cccc3nsnc23)c2ccccc2c1=O |
| InChI | InChI=1S/C23H23N5O4S/c1-2-3-4-7-13-28-22(30)16-10-6-5-9-15(16)20(25-28)23(31)32-14-19(29)24-17-11-8-12-18-21(17)27-33-26-18/h5-6,8-12H,2-4,7,13-14H2,1H3,(H,24,29) |
| InChIKey | LKZDFTZINRGYEX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|