C21H24N4O5 — CID 2603100
[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate (PubChem CID 2603100) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2603100 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 3-hexyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCCCn1nc(C(=O)OCC(=O)Nc2cc(C)on2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H24N4O5/c1-3-4-5-8-11-25-20(27)16-10-7-6-9-15(16)19(23-25)21(28)29-13-18(26)22-17-12-14(2)30-24-17/h6-7,9-10,12H,3-5,8,11,13H2,1-2H3,(H,22,24,26) |
| InChIKey | LAYHIMLTTFBEBP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|