C22H22FN3O4 — CID 7167876
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-butyl-4-oxophthalazine-1-carboxylate (PubChem CID 7167876) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-butyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-butyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7167876 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-butyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCn1nc(C(=O)OCC(=O)Nc2ccc(C)c(F)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H22FN3O4/c1-3-4-11-26-21(28)17-8-6-5-7-16(17)20(25-26)22(29)30-13-19(27)24-15-10-9-14(2)18(23)12-15/h5-10,12H,3-4,11,13H2,1-2H3,(H,24,27) |
| InChIKey | JVSBPRAVJXEGHY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |