C23H22N4O4 — CID 8951823
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-butyl-4-oxophthalazine-1-carboxylate (PubChem CID 8951823) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-butyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-butyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8951823 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-butyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCn1nc(C(=O)OCC(=O)Nc2ccc(CC#N)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H22N4O4/c1-2-3-14-27-22(29)19-7-5-4-6-18(19)21(26-27)23(30)31-15-20(28)25-17-10-8-16(9-11-17)12-13-24/h4-11H,2-3,12,14-15H2,1H3,(H,25,28) |
| InChIKey | NNCCQSAJPHGSPC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |