C26H30N4O5 — CID 55325325
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 55325325) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 55325325 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCC(=O)Nc2ccc(N3CCOCC3)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C26H30N4O5/c1-2-3-6-13-30-25(32)22-8-5-4-7-21(22)24(28-30)26(33)35-18-23(31)27-19-9-11-20(12-10-19)29-14-16-34-17-15-29/h4-5,7-12H,2-3,6,13-18H2,1H3,(H,27,31) |
| InChIKey | OAMUYWOKPXYCGH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|