C25H28N4O4 — CID 16502557
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 4-oxo-3-propylphthalazine-1-carboxylate (PubChem CID 16502557) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 4-oxo-3-propylphthalazine-1-carboxylate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 4-oxo-3-propylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 16502557 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 4-oxo-3-propylphthalazine-1-carboxylate |
| SMILES | CCCn1nc(C(=O)OCC(=O)Nc2ccc(N3CCCCC3)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H28N4O4/c1-2-14-29-24(31)21-9-5-4-8-20(21)23(27-29)25(32)33-17-22(30)26-18-10-12-19(13-11-18)28-15-6-3-7-16-28/h4-5,8-13H,2-3,6-7,14-17H2,1H3,(H,26,30) |
| InChIKey | YRBYJGXHWRMVPT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|