C24H26N4O6S — CID 16502593
[2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 4-oxo-3-propylphthalazine-1-carboxylate (PubChem CID 16502593) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 4-oxo-3-propylphthalazine-1-carboxylate.
| Compound Name | [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 4-oxo-3-propylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 16502593 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 4-oxo-3-propylphthalazine-1-carboxylate |
| SMILES | CCCn1nc(C(=O)OCC(=O)Nc2cccc(S(=O)(=O)N3CCCC3)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H26N4O6S/c1-2-12-28-23(30)20-11-4-3-10-19(20)22(26-28)24(31)34-16-21(29)25-17-8-7-9-18(15-17)35(32,33)27-13-5-6-14-27/h3-4,7-11,15H,2,5-6,12-14,16H2,1H3,(H,25,29) |
| InChIKey | RSGWNYNOZJPDFP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |