C15H22N2O4S — CID 35728244
2-ethoxy-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 35728244) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-ethoxy-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-ethoxy-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 35728244 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-ethoxy-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CCOCC(=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C15H22N2O4S/c1-2-21-12-15(18)16-13-7-6-8-14(11-13)22(19,20)17-9-4-3-5-10-17/h6-8,11H,2-5,9-10,12H2,1H3,(H,16,18) |
| InChIKey | RPSQLKQGVXMKCQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |