C20H26N3O3S+ — CID 8857790
2-(4-ethylpyridin-1-ium-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 8857790) has the molecular formula C20H26N3O3S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-(4-ethylpyridin-1-ium-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-ethylpyridin-1-ium-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 8857790 |
| Molecular Formula | C20H26N3O3S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-(4-ethylpyridin-1-ium-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CCc1cc[n+](CC(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-2-17-9-13-22(14-10-17)16-20(24)21-18-7-6-8-19(15-18)27(25,26)23-11-4-3-5-12-23/h6-10,13-15H,2-5,11-12,16H2,1H3/p+1 |
| InChIKey | JAPOVZDNKRUEAQ-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|