C21H22N3O3S+ — CID 8829347
2-isoquinolin-2-ium-2-yl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 8829347) has the molecular formula C21H22N3O3S+ and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-isoquinolin-2-ium-2-yl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-isoquinolin-2-ium-2-yl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 8829347 |
| Molecular Formula | C21H22N3O3S+ |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-isoquinolin-2-ium-2-yl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(C[n+]1ccc2ccccc2c1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H21N3O3S/c25-21(16-23-13-10-17-6-1-2-7-18(17)15-23)22-19-8-5-9-20(14-19)28(26,27)24-11-3-4-12-24/h1-2,5-10,13-15H,3-4,11-12,16H2/p+1 |
| InChIKey | PACNMZJNXVKEIT-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|