C22H30N3O3S+ — CID 8877671
N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-propylpyridin-1-ium-1-yl)acetamide (PubChem CID 8877671) has the molecular formula C22H30N3O3S+ and a molecular weight of 416.57 g/mol. Its IUPAC name is N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-propylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-propylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8877671 |
| Molecular Formula | C22H30N3O3S+ |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-propylpyridin-1-ium-1-yl)acetamide |
| SMILES | CCCc1cc[n+](CC(=O)Nc2ccc(C)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H29N3O3S/c1-3-7-19-10-14-24(15-11-19)17-22(26)23-20-9-8-18(2)21(16-20)29(27,28)25-12-5-4-6-13-25/h8-11,14-16H,3-7,12-13,17H2,1-2H3/p+1 |
| InChIKey | LOOKFMAONJKSJK-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|