C20H29N3O4S — CID 31321213
N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(2-oxoazepan-1-yl)acetamide (PubChem CID 31321213) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(2-oxoazepan-1-yl)acetamide.
| Compound Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(2-oxoazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 31321213 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(2-oxoazepan-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCCCCC2=O)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H29N3O4S/c1-16-9-10-17(14-18(16)28(26,27)23-12-6-3-7-13-23)21-19(24)15-22-11-5-2-4-8-20(22)25/h9-10,14H,2-8,11-13,15H2,1H3,(H,21,24) |
| InChIKey | NQLYZQYCPFMYRX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |