C20H28N4O5S — CID 55383406
4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)butanamide (PubChem CID 55383406) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 55383406 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCN2C(=O)CN(C)C2=O)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H28N4O5S/c1-15-8-9-16(13-17(15)30(28,29)23-10-4-3-5-11-23)21-18(25)7-6-12-24-19(26)14-22(2)20(24)27/h8-9,13H,3-7,10-12,14H2,1-2H3,(H,21,25) |
| InChIKey | SFCUNGUYNWXZQB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|