C20H29N5O5S — CID 55383950
N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 55383950) has the molecular formula C20H29N5O5S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 55383950 |
| Molecular Formula | C20H29N5O5S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CCN1CCN(S(=O)(=O)c2cccc(NC(=O)CCCN3C(=O)CN(C)C3=O)c2)CC1 |
| InChI | InChI=1S/C20H29N5O5S/c1-3-23-10-12-24(13-11-23)31(29,30)17-7-4-6-16(14-17)21-18(26)8-5-9-25-19(27)15-22(2)20(25)28/h4,6-7,14H,3,5,8-13,15H2,1-2H3,(H,21,26) |
| InChIKey | FUFQOSDQSPWSOW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|