C19H24N4O6S — CID 18205489
2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 18205489) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 18205489 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)Nc2cccc(S(=O)(=O)N3CCCC3)c2)C1=O |
| InChI | InChI=1S/C19H24N4O6S/c1-2-3-11-22-17(25)18(26)23(19(22)27)13-16(24)20-14-7-6-8-15(12-14)30(28,29)21-9-4-5-10-21/h6-8,12H,2-5,9-11,13H2,1H3,(H,20,24) |
| InChIKey | PMTRJMFENCHXPA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|