C23H25N3O4S — CID 16591807
N-[3-(azepan-1-ylsulfonyl)phenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide (PubChem CID 16591807) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 16591807 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-17-20-11-4-5-12-21(20)23(28)26(17)16-22(27)24-18-9-8-10-19(15-18)31(29,30)25-13-6-2-3-7-14-25/h4-5,8-12,15H,1-3,6-7,13-14,16H2,(H,24,27) |
| InChIKey | YKEBZBRPHIOCMY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |