C22H22ClN3O5S — CID 3312619
N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 3312619) has the molecular formula C22H22ClN3O5S and a molecular weight of 475.95 g/mol. Its IUPAC name is N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 3312619 |
| Molecular Formula | C22H22ClN3O5S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C22H22ClN3O5S/c23-18-10-9-15(32(30,31)25-11-5-1-2-6-12-25)13-19(18)24-20(27)14-26-21(28)16-7-3-4-8-17(16)22(26)29/h3-4,7-10,13H,1-2,5-6,11-12,14H2,(H,24,27) |
| InChIKey | RXSNRMQZLXNXDX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|