C20H23ClN2O3S2 — CID 3984580
N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-phenylsulfanylacetamide (PubChem CID 3984580) has the molecular formula C20H23ClN2O3S2 and a molecular weight of 439.00 g/mol. Its IUPAC name is N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 3984580 |
| Molecular Formula | C20H23ClN2O3S2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)Nc1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C20H23ClN2O3S2/c21-18-11-10-17(28(25,26)23-12-6-1-2-7-13-23)14-19(18)22-20(24)15-27-16-8-4-3-5-9-16/h3-5,8-11,14H,1-2,6-7,12-13,15H2,(H,22,24) |
| InChIKey | INYDNMJWXUWPND-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |