C17H23ClN2O3S2 — CID 7395638
N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-2-cyclopentylsulfanylacetamide (PubChem CID 7395638) has the molecular formula C17H23ClN2O3S2 and a molecular weight of 402.97 g/mol. Its IUPAC name is N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-2-cyclopentylsulfanylacetamide.
| Compound Name | N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-2-cyclopentylsulfanylacetamide |
|---|---|
| PubChem CID | 7395638 |
| Molecular Formula | C17H23ClN2O3S2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-2-cyclopentylsulfanylacetamide |
| SMILES | O=C(CSC1CCCC1)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C17H23ClN2O3S2/c18-15-8-7-14(25(22,23)20-9-3-4-10-20)11-16(15)19-17(21)12-24-13-5-1-2-6-13/h7-8,11,13H,1-6,9-10,12H2,(H,19,21) |
| InChIKey | PVVGIVIRPZDMAA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |