C18H24ClN3O3S2 — CID 4056583
N-[(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]cyclohexanecarboxamide (PubChem CID 4056583) has the molecular formula C18H24ClN3O3S2 and a molecular weight of 430.00 g/mol. Its IUPAC name is N-[(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]cyclohexanecarboxamide.
| Compound Name | N-[(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4056583 |
| Molecular Formula | C18H24ClN3O3S2 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]cyclohexanecarboxamide |
| SMILES | O=C(NC(=S)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C18H24ClN3O3S2/c19-15-9-8-14(27(24,25)22-10-4-5-11-22)12-16(15)20-18(26)21-17(23)13-6-2-1-3-7-13/h8-9,12-13H,1-7,10-11H2,(H2,20,21,23,26) |
| InChIKey | JRJIKYHSWNEZAX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|