C19H19ClN2O4S — CID 91687917
5-[4-chloro-3-(cyclohexanecarbonylcarbamothioylamino)phenyl]furan-2-carboxylic acid (PubChem CID 91687917) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is 5-[4-chloro-3-(cyclohexanecarbonylcarbamothioylamino)phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-chloro-3-(cyclohexanecarbonylcarbamothioylamino)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 91687917 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 5-[4-chloro-3-(cyclohexanecarbonylcarbamothioylamino)phenyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(Cl)c(NC(=S)NC(=O)C3CCCCC3)c2)o1 |
| InChI | InChI=1S/C19H19ClN2O4S/c20-13-7-6-12(15-8-9-16(26-15)18(24)25)10-14(13)21-19(27)22-17(23)11-4-2-1-3-5-11/h6-11H,1-5H2,(H,24,25)(H2,21,22,23,27) |
| InChIKey | PQIQNVIESYMVDH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|