C17H19ClN2O3S — CID 28686820
N-[[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 28686820) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is N-[[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 28686820 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC(=S)Nc1cc(-c2ccc(CO)o2)ccc1Cl |
| InChI | InChI=1S/C17H19ClN2O3S/c1-17(2,3)15(22)20-16(24)19-13-8-10(4-6-12(13)18)14-7-5-11(9-21)23-14/h4-8,21H,9H2,1-3H3,(H2,19,20,22,24) |
| InChIKey | PQACHJQUNMSCKB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|