C16H18ClNO3 — CID 28666016
N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-methylbutanamide (PubChem CID 28666016) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-methylbutanamide.
| Compound Name | N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 28666016 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1cc(-c2ccc(CO)o2)ccc1Cl |
| InChI | InChI=1S/C16H18ClNO3/c1-10(2)7-16(20)18-14-8-11(3-5-13(14)17)15-6-4-12(9-19)21-15/h3-6,8,10,19H,7,9H2,1-2H3,(H,18,20) |
| InChIKey | HMSTWRUQNLEMBF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |