C19H15Cl2NO3 — CID 28666384
N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-2-(4-chlorophenyl)acetamide (PubChem CID 28666384) has the molecular formula C19H15Cl2NO3 and a molecular weight of 376.24 g/mol. Its IUPAC name is N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 28666384 |
| Molecular Formula | C19H15Cl2NO3 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1cc(-c2ccc(CO)o2)ccc1Cl |
| InChI | InChI=1S/C19H15Cl2NO3/c20-14-4-1-12(2-5-14)9-19(24)22-17-10-13(3-7-16(17)21)18-8-6-15(11-23)25-18/h1-8,10,23H,9,11H2,(H,22,24) |
| InChIKey | AOCLQAWFTOWHIJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |